C26H28ClN3O4S — CID 5178494
2-chloro-N-(2,3-dimethylphenyl)-5-[4-(4-methoxyphenyl)piperazine-1-carbonyl]benzenesulfonamide (PubChem CID 5178494) has the molecular formula C26H28ClN3O4S and a molecular weight of 514.05 g/mol. Its IUPAC name is 2-chloro-N-(2,3-dimethylphenyl)-5-[4-(4-methoxyphenyl)piperazine-1-carbonyl]benzenesulfonamide.
| Compound Name | 2-chloro-N-(2,3-dimethylphenyl)-5-[4-(4-methoxyphenyl)piperazine-1-carbonyl]benzenesulfonamide |
|---|---|
| PubChem CID | 5178494 |
| Molecular Formula | C26H28ClN3O4S |
| Molecular Weight | 514.05 g/mol |
| Exact Mass | 513.15 |
| IUPAC Name | 2-chloro-N-(2,3-dimethylphenyl)-5-[4-(4-methoxyphenyl)piperazine-1-carbonyl]benzenesulfonamide |
| SMILES | COc1ccc(N2CCN(C(=O)c3ccc(Cl)c(S(=O)(=O)Nc4cccc(C)c4C)c3)CC2)cc1 |
| InChI | InChI=1S/C26H28ClN3O4S/c1-18-5-4-6-24(19(18)2)28-35(32,33)25-17-20(7-12-23(25)27)26(31)30-15-13-29(14-16-30)21-8-10-22(34-3)11-9-21/h4-12,17,28H,13-16H2,1-3H3 |
| InChIKey | IXLUIWJCOOCQKW-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.05 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|