C18H20ClN3O4S — CID 4790784
2-chloro-5-[4-(4-methoxyphenyl)piperazine-1-carbonyl]benzenesulfonamide (PubChem CID 4790784) has the molecular formula C18H20ClN3O4S and a molecular weight of 409.90 g/mol. Its IUPAC name is 2-chloro-5-[4-(4-methoxyphenyl)piperazine-1-carbonyl]benzenesulfonamide.
| Compound Name | 2-chloro-5-[4-(4-methoxyphenyl)piperazine-1-carbonyl]benzenesulfonamide |
|---|---|
| PubChem CID | 4790784 |
| Molecular Formula | C18H20ClN3O4S |
| Molecular Weight | 409.90 g/mol |
| Exact Mass | 409.09 |
| IUPAC Name | 2-chloro-5-[4-(4-methoxyphenyl)piperazine-1-carbonyl]benzenesulfonamide |
| SMILES | COc1ccc(N2CCN(C(=O)c3ccc(Cl)c(S(N)(=O)=O)c3)CC2)cc1 |
| InChI | InChI=1S/C18H20ClN3O4S/c1-26-15-5-3-14(4-6-15)21-8-10-22(11-9-21)18(23)13-2-7-16(19)17(12-13)27(20,24)25/h2-7,12H,8-11H2,1H3,(H2,20,24,25) |
| InChIKey | LHAZRYBIUMXZBA-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 92.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.90 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|