C27H31N3O4S — CID 126415422
N-(3,4-dimethylphenyl)-5-[4-(4-methoxyphenyl)piperazine-1-carbonyl]-2-methylbenzenesulfonamide (PubChem CID 126415422) has the molecular formula C27H31N3O4S and a molecular weight of 493.63 g/mol. Its IUPAC name is N-(3,4-dimethylphenyl)-5-[4-(4-methoxyphenyl)piperazine-1-carbonyl]-2-methylbenzenesulfonamide.
| Compound Name | N-(3,4-dimethylphenyl)-5-[4-(4-methoxyphenyl)piperazine-1-carbonyl]-2-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 126415422 |
| Molecular Formula | C27H31N3O4S |
| Molecular Weight | 493.63 g/mol |
| Exact Mass | 493.20 |
| IUPAC Name | N-(3,4-dimethylphenyl)-5-[4-(4-methoxyphenyl)piperazine-1-carbonyl]-2-methylbenzenesulfonamide |
| SMILES | COc1ccc(N2CCN(C(=O)c3ccc(C)c(S(=O)(=O)Nc4ccc(C)c(C)c4)c3)CC2)cc1 |
| InChI | InChI=1S/C27H31N3O4S/c1-19-6-8-23(17-21(19)3)28-35(32,33)26-18-22(7-5-20(26)2)27(31)30-15-13-29(14-16-30)24-9-11-25(34-4)12-10-24/h5-12,17-18,28H,13-16H2,1-4H3 |
| InChIKey | TZGQHNBXTDLYDM-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.63 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|