C19H22N2O4S2 — CID 55869067
N-(4-methoxyphenyl)-2-methyl-5-(thiomorpholine-4-carbonyl)benzenesulfonamide (PubChem CID 55869067) has the molecular formula C19H22N2O4S2 and a molecular weight of 406.53 g/mol. Its IUPAC name is N-(4-methoxyphenyl)-2-methyl-5-(thiomorpholine-4-carbonyl)benzenesulfonamide.
| Compound Name | N-(4-methoxyphenyl)-2-methyl-5-(thiomorpholine-4-carbonyl)benzenesulfonamide |
|---|---|
| PubChem CID | 55869067 |
| Molecular Formula | C19H22N2O4S2 |
| Molecular Weight | 406.53 g/mol |
| Exact Mass | 406.10 |
| IUPAC Name | N-(4-methoxyphenyl)-2-methyl-5-(thiomorpholine-4-carbonyl)benzenesulfonamide |
| SMILES | COc1ccc(NS(=O)(=O)c2cc(C(=O)N3CCSCC3)ccc2C)cc1 |
| InChI | InChI=1S/C19H22N2O4S2/c1-14-3-4-15(19(22)21-9-11-26-12-10-21)13-18(14)27(23,24)20-16-5-7-17(25-2)8-6-16/h3-8,13,20H,9-12H2,1-2H3 |
| InChIKey | DYXMNYZQIDSWFT-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.53 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |