C22H22N2O8S2 — CID 4005118
4-methoxy-3-[[3-[(4-methoxyphenyl)sulfamoyl]-4-methylphenyl]sulfamoyl]benzoic acid (PubChem CID 4005118) has the molecular formula C22H22N2O8S2 and a molecular weight of 506.56 g/mol. Its IUPAC name is 4-methoxy-3-[[3-[(4-methoxyphenyl)sulfamoyl]-4-methylphenyl]sulfamoyl]benzoic acid.
| Compound Name | 4-methoxy-3-[[3-[(4-methoxyphenyl)sulfamoyl]-4-methylphenyl]sulfamoyl]benzoic acid |
|---|---|
| PubChem CID | 4005118 |
| Molecular Formula | C22H22N2O8S2 |
| Molecular Weight | 506.56 g/mol |
| Exact Mass | 506.08 |
| IUPAC Name | 4-methoxy-3-[[3-[(4-methoxyphenyl)sulfamoyl]-4-methylphenyl]sulfamoyl]benzoic acid |
| SMILES | COc1ccc(NS(=O)(=O)c2cc(NS(=O)(=O)c3cc(C(=O)O)ccc3OC)ccc2C)cc1 |
| InChI | InChI=1S/C22H22N2O8S2/c1-14-4-6-17(13-20(14)33(27,28)23-16-7-9-18(31-2)10-8-16)24-34(29,30)21-12-15(22(25)26)5-11-19(21)32-3/h4-13,23-24H,1-3H3,(H,25,26) |
| InChIKey | FBQWSAUJDUJXKC-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 148.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.56 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |