C28H31N3O4 — CID 17335458
2-(3,4-dimethylphenoxy)-N-[4-[4-(4-methoxybenzoyl)piperazin-1-yl]phenyl]acetamide (PubChem CID 17335458) has the molecular formula C28H31N3O4 and a molecular weight of 473.57 g/mol. Its IUPAC name is 2-(3,4-dimethylphenoxy)-N-[4-[4-(4-methoxybenzoyl)piperazin-1-yl]phenyl]acetamide.
| Compound Name | 2-(3,4-dimethylphenoxy)-N-[4-[4-(4-methoxybenzoyl)piperazin-1-yl]phenyl]acetamide |
|---|---|
| PubChem CID | 17335458 |
| Molecular Formula | C28H31N3O4 |
| Molecular Weight | 473.57 g/mol |
| Exact Mass | 473.23 |
| IUPAC Name | 2-(3,4-dimethylphenoxy)-N-[4-[4-(4-methoxybenzoyl)piperazin-1-yl]phenyl]acetamide |
| SMILES | COc1ccc(C(=O)N2CCN(c3ccc(NC(=O)COc4ccc(C)c(C)c4)cc3)CC2)cc1 |
| InChI | InChI=1S/C28H31N3O4/c1-20-4-11-26(18-21(20)2)35-19-27(32)29-23-7-9-24(10-8-23)30-14-16-31(17-15-30)28(33)22-5-12-25(34-3)13-6-22/h4-13,18H,14-17,19H2,1-3H3,(H,29,32) |
| InChIKey | CKNRJYRAKGZMKO-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 71.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.57 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|