C27H28ClN3O4 — CID 17335450
2-(4-chloro-2-methylphenoxy)-N-[4-[4-(4-methoxybenzoyl)piperazin-1-yl]phenyl]acetamide (PubChem CID 17335450) has the molecular formula C27H28ClN3O4 and a molecular weight of 493.99 g/mol. Its IUPAC name is 2-(4-chloro-2-methylphenoxy)-N-[4-[4-(4-methoxybenzoyl)piperazin-1-yl]phenyl]acetamide.
| Compound Name | 2-(4-chloro-2-methylphenoxy)-N-[4-[4-(4-methoxybenzoyl)piperazin-1-yl]phenyl]acetamide |
|---|---|
| PubChem CID | 17335450 |
| Molecular Formula | C27H28ClN3O4 |
| Molecular Weight | 493.99 g/mol |
| Exact Mass | 493.18 |
| IUPAC Name | 2-(4-chloro-2-methylphenoxy)-N-[4-[4-(4-methoxybenzoyl)piperazin-1-yl]phenyl]acetamide |
| SMILES | COc1ccc(C(=O)N2CCN(c3ccc(NC(=O)COc4ccc(Cl)cc4C)cc3)CC2)cc1 |
| InChI | InChI=1S/C27H28ClN3O4/c1-19-17-21(28)5-12-25(19)35-18-26(32)29-22-6-8-23(9-7-22)30-13-15-31(16-14-30)27(33)20-3-10-24(34-2)11-4-20/h3-12,17H,13-16,18H2,1-2H3,(H,29,32) |
| InChIKey | NUADZBGAGZBFHE-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 71.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.99 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|