C30H33ClN4O5 — CID 42676145
4-chloro-N-[2-[4-[4-(4-methoxybenzoyl)piperazin-1-yl]anilino]-2-oxoethyl]-N-(2-methoxyethyl)benzamide (PubChem CID 42676145) has the molecular formula C30H33ClN4O5 and a molecular weight of 565.07 g/mol. Its IUPAC name is 4-chloro-N-[2-[4-[4-(4-methoxybenzoyl)piperazin-1-yl]anilino]-2-oxoethyl]-N-(2-methoxyethyl)benzamide.
| Compound Name | 4-chloro-N-[2-[4-[4-(4-methoxybenzoyl)piperazin-1-yl]anilino]-2-oxoethyl]-N-(2-methoxyethyl)benzamide |
|---|---|
| PubChem CID | 42676145 |
| Molecular Formula | C30H33ClN4O5 |
| Molecular Weight | 565.07 g/mol |
| Exact Mass | 564.21 |
| IUPAC Name | 4-chloro-N-[2-[4-[4-(4-methoxybenzoyl)piperazin-1-yl]anilino]-2-oxoethyl]-N-(2-methoxyethyl)benzamide |
| SMILES | COCCN(CC(=O)Nc1ccc(N2CCN(C(=O)c3ccc(OC)cc3)CC2)cc1)C(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C30H33ClN4O5/c1-39-20-19-35(30(38)22-3-7-24(31)8-4-22)21-28(36)32-25-9-11-26(12-10-25)33-15-17-34(18-16-33)29(37)23-5-13-27(40-2)14-6-23/h3-14H,15-21H2,1-2H3,(H,32,36) |
| InChIKey | ZHWIQNRXQJKDDW-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 91.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.07 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|