C29H30ClFN4O4 — CID 42676358
2-chloro-N-[2-[4-[4-(2-fluorobenzoyl)piperazin-1-yl]anilino]-2-oxoethyl]-N-(2-methoxyethyl)benzamide (PubChem CID 42676358) has the molecular formula C29H30ClFN4O4 and a molecular weight of 553.03 g/mol. Its IUPAC name is 2-chloro-N-[2-[4-[4-(2-fluorobenzoyl)piperazin-1-yl]anilino]-2-oxoethyl]-N-(2-methoxyethyl)benzamide.
| Compound Name | 2-chloro-N-[2-[4-[4-(2-fluorobenzoyl)piperazin-1-yl]anilino]-2-oxoethyl]-N-(2-methoxyethyl)benzamide |
|---|---|
| PubChem CID | 42676358 |
| Molecular Formula | C29H30ClFN4O4 |
| Molecular Weight | 553.03 g/mol |
| Exact Mass | 552.19 |
| IUPAC Name | 2-chloro-N-[2-[4-[4-(2-fluorobenzoyl)piperazin-1-yl]anilino]-2-oxoethyl]-N-(2-methoxyethyl)benzamide |
| SMILES | COCCN(CC(=O)Nc1ccc(N2CCN(C(=O)c3ccccc3F)CC2)cc1)C(=O)c1ccccc1Cl |
| InChI | InChI=1S/C29H30ClFN4O4/c1-39-19-18-35(28(37)23-6-2-4-8-25(23)30)20-27(36)32-21-10-12-22(13-11-21)33-14-16-34(17-15-33)29(38)24-7-3-5-9-26(24)31/h2-13H,14-20H2,1H3,(H,32,36) |
| InChIKey | BTJRNRKMKZPPFH-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 82.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.03 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|