C28H30ClFN4O5S — CID 42676841
2-[(4-chlorophenyl)sulfonyl-(2-methoxyethyl)amino]-N-[4-[4-(2-fluorobenzoyl)piperazin-1-yl]phenyl]acetamide (PubChem CID 42676841) has the molecular formula C28H30ClFN4O5S and a molecular weight of 589.09 g/mol. Its IUPAC name is 2-[(4-chlorophenyl)sulfonyl-(2-methoxyethyl)amino]-N-[4-[4-(2-fluorobenzoyl)piperazin-1-yl]phenyl]acetamide.
| Compound Name | 2-[(4-chlorophenyl)sulfonyl-(2-methoxyethyl)amino]-N-[4-[4-(2-fluorobenzoyl)piperazin-1-yl]phenyl]acetamide |
|---|---|
| PubChem CID | 42676841 |
| Molecular Formula | C28H30ClFN4O5S |
| Molecular Weight | 589.09 g/mol |
| Exact Mass | 588.16 |
| IUPAC Name | 2-[(4-chlorophenyl)sulfonyl-(2-methoxyethyl)amino]-N-[4-[4-(2-fluorobenzoyl)piperazin-1-yl]phenyl]acetamide |
| SMILES | COCCN(CC(=O)Nc1ccc(N2CCN(C(=O)c3ccccc3F)CC2)cc1)S(=O)(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C28H30ClFN4O5S/c1-39-19-18-34(40(37,38)24-12-6-21(29)7-13-24)20-27(35)31-22-8-10-23(11-9-22)32-14-16-33(17-15-32)28(36)25-4-2-3-5-26(25)30/h2-13H,14-20H2,1H3,(H,31,35) |
| InChIKey | NSPLLELHBVWMGO-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 99.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.09 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|