C29H35N5O5S — CID 42675184
4-[4-[[2-[benzenesulfonyl(propyl)amino]acetyl]amino]phenyl]-N-(4-methoxyphenyl)piperazine-1-carboxamide (PubChem CID 42675184) has the molecular formula C29H35N5O5S and a molecular weight of 565.70 g/mol. Its IUPAC name is 4-[4-[[2-[benzenesulfonyl(propyl)amino]acetyl]amino]phenyl]-N-(4-methoxyphenyl)piperazine-1-carboxamide.
| Compound Name | 4-[4-[[2-[benzenesulfonyl(propyl)amino]acetyl]amino]phenyl]-N-(4-methoxyphenyl)piperazine-1-carboxamide |
|---|---|
| PubChem CID | 42675184 |
| Molecular Formula | C29H35N5O5S |
| Molecular Weight | 565.70 g/mol |
| Exact Mass | 565.24 |
| IUPAC Name | 4-[4-[[2-[benzenesulfonyl(propyl)amino]acetyl]amino]phenyl]-N-(4-methoxyphenyl)piperazine-1-carboxamide |
| SMILES | CCCN(CC(=O)Nc1ccc(N2CCN(C(=O)Nc3ccc(OC)cc3)CC2)cc1)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C29H35N5O5S/c1-3-17-34(40(37,38)27-7-5-4-6-8-27)22-28(35)30-23-9-13-25(14-10-23)32-18-20-33(21-19-32)29(36)31-24-11-15-26(39-2)16-12-24/h4-16H,3,17-22H2,1-2H3,(H,30,35)(H,31,36) |
| InChIKey | NGAVHBOZRWMWLM-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 111.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.70 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|