C30H34FN5O4 — CID 42675503
4-[4-[[2-[(4-fluorobenzoyl)-propan-2-ylamino]acetyl]amino]phenyl]-N-(4-methoxyphenyl)piperazine-1-carboxamide (PubChem CID 42675503) has the molecular formula C30H34FN5O4 and a molecular weight of 547.63 g/mol. Its IUPAC name is 4-[4-[[2-[(4-fluorobenzoyl)-propan-2-ylamino]acetyl]amino]phenyl]-N-(4-methoxyphenyl)piperazine-1-carboxamide.
| Compound Name | 4-[4-[[2-[(4-fluorobenzoyl)-propan-2-ylamino]acetyl]amino]phenyl]-N-(4-methoxyphenyl)piperazine-1-carboxamide |
|---|---|
| PubChem CID | 42675503 |
| Molecular Formula | C30H34FN5O4 |
| Molecular Weight | 547.63 g/mol |
| Exact Mass | 547.26 |
| IUPAC Name | 4-[4-[[2-[(4-fluorobenzoyl)-propan-2-ylamino]acetyl]amino]phenyl]-N-(4-methoxyphenyl)piperazine-1-carboxamide |
| SMILES | COc1ccc(NC(=O)N2CCN(c3ccc(NC(=O)CN(C(=O)c4ccc(F)cc4)C(C)C)cc3)CC2)cc1 |
| InChI | InChI=1S/C30H34FN5O4/c1-21(2)36(29(38)22-4-6-23(31)7-5-22)20-28(37)32-24-8-12-26(13-9-24)34-16-18-35(19-17-34)30(39)33-25-10-14-27(40-3)15-11-25/h4-15,21H,16-20H2,1-3H3,(H,32,37)(H,33,39) |
| InChIKey | KDAGBEVOOOMGIF-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 94.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.63 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|