C30H33FN4O5 — CID 42676217
2-[(4-fluorophenyl)methyl-(2-methoxyacetyl)amino]-N-[4-[4-(4-methoxybenzoyl)piperazin-1-yl]phenyl]acetamide (PubChem CID 42676217) has the molecular formula C30H33FN4O5 and a molecular weight of 548.62 g/mol. Its IUPAC name is 2-[(4-fluorophenyl)methyl-(2-methoxyacetyl)amino]-N-[4-[4-(4-methoxybenzoyl)piperazin-1-yl]phenyl]acetamide.
| Compound Name | 2-[(4-fluorophenyl)methyl-(2-methoxyacetyl)amino]-N-[4-[4-(4-methoxybenzoyl)piperazin-1-yl]phenyl]acetamide |
|---|---|
| PubChem CID | 42676217 |
| Molecular Formula | C30H33FN4O5 |
| Molecular Weight | 548.62 g/mol |
| Exact Mass | 548.24 |
| IUPAC Name | 2-[(4-fluorophenyl)methyl-(2-methoxyacetyl)amino]-N-[4-[4-(4-methoxybenzoyl)piperazin-1-yl]phenyl]acetamide |
| SMILES | COCC(=O)N(CC(=O)Nc1ccc(N2CCN(C(=O)c3ccc(OC)cc3)CC2)cc1)Cc1ccc(F)cc1 |
| InChI | InChI=1S/C30H33FN4O5/c1-39-21-29(37)35(19-22-3-7-24(31)8-4-22)20-28(36)32-25-9-11-26(12-10-25)33-15-17-34(18-16-33)30(38)23-5-13-27(40-2)14-6-23/h3-14H,15-21H2,1-2H3,(H,32,36) |
| InChIKey | UAECOJFPLGVKNM-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 91.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.62 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|