C31H33FN4O4 — CID 42676212
N-[(4-fluorophenyl)methyl]-N-[2-[4-[4-(4-methoxybenzoyl)piperazin-1-yl]anilino]-2-oxoethyl]cyclopropanecarboxamide (PubChem CID 42676212) has the molecular formula C31H33FN4O4 and a molecular weight of 544.63 g/mol. Its IUPAC name is N-[(4-fluorophenyl)methyl]-N-[2-[4-[4-(4-methoxybenzoyl)piperazin-1-yl]anilino]-2-oxoethyl]cyclopropanecarboxamide.
| Compound Name | N-[(4-fluorophenyl)methyl]-N-[2-[4-[4-(4-methoxybenzoyl)piperazin-1-yl]anilino]-2-oxoethyl]cyclopropanecarboxamide |
|---|---|
| PubChem CID | 42676212 |
| Molecular Formula | C31H33FN4O4 |
| Molecular Weight | 544.63 g/mol |
| Exact Mass | 544.25 |
| IUPAC Name | N-[(4-fluorophenyl)methyl]-N-[2-[4-[4-(4-methoxybenzoyl)piperazin-1-yl]anilino]-2-oxoethyl]cyclopropanecarboxamide |
| SMILES | COc1ccc(C(=O)N2CCN(c3ccc(NC(=O)CN(Cc4ccc(F)cc4)C(=O)C4CC4)cc3)CC2)cc1 |
| InChI | InChI=1S/C31H33FN4O4/c1-40-28-14-6-24(7-15-28)30(38)35-18-16-34(17-19-35)27-12-10-26(11-13-27)33-29(37)21-36(31(39)23-4-5-23)20-22-2-8-25(32)9-3-22/h2-3,6-15,23H,4-5,16-21H2,1H3,(H,33,37) |
| InChIKey | GEBGTFJZDRPMIX-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 82.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.63 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|