C31H33FN4O3 — CID 42676473
N-benzyl-N-[2-[4-[4-(3-fluorobenzoyl)piperazin-1-yl]anilino]-2-oxoethyl]cyclobutanecarboxamide (PubChem CID 42676473) has the molecular formula C31H33FN4O3 and a molecular weight of 528.63 g/mol. Its IUPAC name is N-benzyl-N-[2-[4-[4-(3-fluorobenzoyl)piperazin-1-yl]anilino]-2-oxoethyl]cyclobutanecarboxamide.
| Compound Name | N-benzyl-N-[2-[4-[4-(3-fluorobenzoyl)piperazin-1-yl]anilino]-2-oxoethyl]cyclobutanecarboxamide |
|---|---|
| PubChem CID | 42676473 |
| Molecular Formula | C31H33FN4O3 |
| Molecular Weight | 528.63 g/mol |
| Exact Mass | 528.25 |
| IUPAC Name | N-benzyl-N-[2-[4-[4-(3-fluorobenzoyl)piperazin-1-yl]anilino]-2-oxoethyl]cyclobutanecarboxamide |
| SMILES | O=C(CN(Cc1ccccc1)C(=O)C1CCC1)Nc1ccc(N2CCN(C(=O)c3cccc(F)c3)CC2)cc1 |
| InChI | InChI=1S/C31H33FN4O3/c32-26-11-5-10-25(20-26)31(39)35-18-16-34(17-19-35)28-14-12-27(13-15-28)33-29(37)22-36(30(38)24-8-4-9-24)21-23-6-2-1-3-7-23/h1-3,5-7,10-15,20,24H,4,8-9,16-19,21-22H2,(H,33,37) |
| InChIKey | OWWSJCZUPLEFFL-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 72.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.63 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|