C32H34F2N4O3 — CID 42676526
N-[2-[4-[4-(3-fluorobenzoyl)piperazin-1-yl]anilino]-2-oxoethyl]-N-[(4-fluorophenyl)methyl]cyclopentanecarboxamide (PubChem CID 42676526) has the molecular formula C32H34F2N4O3 and a molecular weight of 560.65 g/mol. Its IUPAC name is N-[2-[4-[4-(3-fluorobenzoyl)piperazin-1-yl]anilino]-2-oxoethyl]-N-[(4-fluorophenyl)methyl]cyclopentanecarboxamide.
| Compound Name | N-[2-[4-[4-(3-fluorobenzoyl)piperazin-1-yl]anilino]-2-oxoethyl]-N-[(4-fluorophenyl)methyl]cyclopentanecarboxamide |
|---|---|
| PubChem CID | 42676526 |
| Molecular Formula | C32H34F2N4O3 |
| Molecular Weight | 560.65 g/mol |
| Exact Mass | 560.26 |
| IUPAC Name | N-[2-[4-[4-(3-fluorobenzoyl)piperazin-1-yl]anilino]-2-oxoethyl]-N-[(4-fluorophenyl)methyl]cyclopentanecarboxamide |
| SMILES | O=C(CN(Cc1ccc(F)cc1)C(=O)C1CCCC1)Nc1ccc(N2CCN(C(=O)c3cccc(F)c3)CC2)cc1 |
| InChI | InChI=1S/C32H34F2N4O3/c33-26-10-8-23(9-11-26)21-38(31(40)24-4-1-2-5-24)22-30(39)35-28-12-14-29(15-13-28)36-16-18-37(19-17-36)32(41)25-6-3-7-27(34)20-25/h3,6-15,20,24H,1-2,4-5,16-19,21-22H2,(H,35,39) |
| InChIKey | CDZWDHHUAIAYQR-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 72.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.65 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|