C33H38FN5O3 — CID 42676689
4-[4-[[2-[benzyl-(3-fluorobenzoyl)amino]acetyl]amino]phenyl]-N-cyclohexylpiperazine-1-carboxamide (PubChem CID 42676689) has the molecular formula C33H38FN5O3 and a molecular weight of 571.70 g/mol. Its IUPAC name is 4-[4-[[2-[benzyl-(3-fluorobenzoyl)amino]acetyl]amino]phenyl]-N-cyclohexylpiperazine-1-carboxamide.
| Compound Name | 4-[4-[[2-[benzyl-(3-fluorobenzoyl)amino]acetyl]amino]phenyl]-N-cyclohexylpiperazine-1-carboxamide |
|---|---|
| PubChem CID | 42676689 |
| Molecular Formula | C33H38FN5O3 |
| Molecular Weight | 571.70 g/mol |
| Exact Mass | 571.30 |
| IUPAC Name | 4-[4-[[2-[benzyl-(3-fluorobenzoyl)amino]acetyl]amino]phenyl]-N-cyclohexylpiperazine-1-carboxamide |
| SMILES | O=C(CN(Cc1ccccc1)C(=O)c1cccc(F)c1)Nc1ccc(N2CCN(C(=O)NC3CCCCC3)CC2)cc1 |
| InChI | InChI=1S/C33H38FN5O3/c34-27-11-7-10-26(22-27)32(41)39(23-25-8-3-1-4-9-25)24-31(40)35-29-14-16-30(17-15-29)37-18-20-38(21-19-37)33(42)36-28-12-5-2-6-13-28/h1,3-4,7-11,14-17,22,28H,2,5-6,12-13,18-21,23-24H2,(H,35,40)(H,36,42) |
| InChIKey | NGEMHFAFOBDOET-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 84.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.70 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|