C33H30F2N4O3 — CID 42676482
N-benzyl-3-fluoro-N-[2-[4-[4-(3-fluorobenzoyl)piperazin-1-yl]anilino]-2-oxoethyl]benzamide (PubChem CID 42676482) has the molecular formula C33H30F2N4O3 and a molecular weight of 568.62 g/mol. Its IUPAC name is N-benzyl-3-fluoro-N-[2-[4-[4-(3-fluorobenzoyl)piperazin-1-yl]anilino]-2-oxoethyl]benzamide.
| Compound Name | N-benzyl-3-fluoro-N-[2-[4-[4-(3-fluorobenzoyl)piperazin-1-yl]anilino]-2-oxoethyl]benzamide |
|---|---|
| PubChem CID | 42676482 |
| Molecular Formula | C33H30F2N4O3 |
| Molecular Weight | 568.62 g/mol |
| Exact Mass | 568.23 |
| IUPAC Name | N-benzyl-3-fluoro-N-[2-[4-[4-(3-fluorobenzoyl)piperazin-1-yl]anilino]-2-oxoethyl]benzamide |
| SMILES | O=C(CN(Cc1ccccc1)C(=O)c1cccc(F)c1)Nc1ccc(N2CCN(C(=O)c3cccc(F)c3)CC2)cc1 |
| InChI | InChI=1S/C33H30F2N4O3/c34-27-10-4-8-25(20-27)32(41)38-18-16-37(17-19-38)30-14-12-29(13-15-30)36-31(40)23-39(22-24-6-2-1-3-7-24)33(42)26-9-5-11-28(35)21-26/h1-15,20-21H,16-19,22-23H2,(H,36,40) |
| InChIKey | KYVVMHBJECULBV-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 72.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.62 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|