C34H31F4N5O3 — CID 42675539
4-[4-[[2-[benzyl-(3-fluorobenzoyl)amino]acetyl]amino]phenyl]-N-[3-(trifluoromethyl)phenyl]piperazine-1-carboxamide (PubChem CID 42675539) has the molecular formula C34H31F4N5O3 and a molecular weight of 633.65 g/mol. Its IUPAC name is 4-[4-[[2-[benzyl-(3-fluorobenzoyl)amino]acetyl]amino]phenyl]-N-[3-(trifluoromethyl)phenyl]piperazine-1-carboxamide.
| Compound Name | 4-[4-[[2-[benzyl-(3-fluorobenzoyl)amino]acetyl]amino]phenyl]-N-[3-(trifluoromethyl)phenyl]piperazine-1-carboxamide |
|---|---|
| PubChem CID | 42675539 |
| Molecular Formula | C34H31F4N5O3 |
| Molecular Weight | 633.65 g/mol |
| Exact Mass | 633.24 |
| IUPAC Name | 4-[4-[[2-[benzyl-(3-fluorobenzoyl)amino]acetyl]amino]phenyl]-N-[3-(trifluoromethyl)phenyl]piperazine-1-carboxamide |
| SMILES | O=C(CN(Cc1ccccc1)C(=O)c1cccc(F)c1)Nc1ccc(N2CCN(C(=O)Nc3cccc(C(F)(F)F)c3)CC2)cc1 |
| InChI | InChI=1S/C34H31F4N5O3/c35-27-10-4-8-25(20-27)32(45)43(22-24-6-2-1-3-7-24)23-31(44)39-28-12-14-30(15-13-28)41-16-18-42(19-17-41)33(46)40-29-11-5-9-26(21-29)34(36,37)38/h1-15,20-21H,16-19,22-23H2,(H,39,44)(H,40,46) |
| InChIKey | GMHCUELIRCOSRL-UHFFFAOYSA-N |
| XLogP | 6.48 |
| TPSA | 84.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 633.65 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|