C28H37N5O3 — CID 42676680
4-[4-[[2-[acetyl(benzyl)amino]acetyl]amino]phenyl]-N-cyclohexylpiperazine-1-carboxamide (PubChem CID 42676680) has the molecular formula C28H37N5O3 and a molecular weight of 491.64 g/mol. Its IUPAC name is 4-[4-[[2-[acetyl(benzyl)amino]acetyl]amino]phenyl]-N-cyclohexylpiperazine-1-carboxamide.
| Compound Name | 4-[4-[[2-[acetyl(benzyl)amino]acetyl]amino]phenyl]-N-cyclohexylpiperazine-1-carboxamide |
|---|---|
| PubChem CID | 42676680 |
| Molecular Formula | C28H37N5O3 |
| Molecular Weight | 491.64 g/mol |
| Exact Mass | 491.29 |
| IUPAC Name | 4-[4-[[2-[acetyl(benzyl)amino]acetyl]amino]phenyl]-N-cyclohexylpiperazine-1-carboxamide |
| SMILES | CC(=O)N(CC(=O)Nc1ccc(N2CCN(C(=O)NC3CCCCC3)CC2)cc1)Cc1ccccc1 |
| InChI | InChI=1S/C28H37N5O3/c1-22(34)33(20-23-8-4-2-5-9-23)21-27(35)29-25-12-14-26(15-13-25)31-16-18-32(19-17-31)28(36)30-24-10-6-3-7-11-24/h2,4-5,8-9,12-15,24H,3,6-7,10-11,16-21H2,1H3,(H,29,35)(H,30,36) |
| InChIKey | UKFCLBZJQOHSCA-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 84.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.64 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|