C29H38N4O5 — CID 42676144
N-[2-[4-[4-(4-methoxybenzoyl)piperazin-1-yl]anilino]-2-oxoethyl]-N-(2-methoxyethyl)cyclopentanecarboxamide (PubChem CID 42676144) has the molecular formula C29H38N4O5 and a molecular weight of 522.65 g/mol. Its IUPAC name is N-[2-[4-[4-(4-methoxybenzoyl)piperazin-1-yl]anilino]-2-oxoethyl]-N-(2-methoxyethyl)cyclopentanecarboxamide.
| Compound Name | N-[2-[4-[4-(4-methoxybenzoyl)piperazin-1-yl]anilino]-2-oxoethyl]-N-(2-methoxyethyl)cyclopentanecarboxamide |
|---|---|
| PubChem CID | 42676144 |
| Molecular Formula | C29H38N4O5 |
| Molecular Weight | 522.65 g/mol |
| Exact Mass | 522.28 |
| IUPAC Name | N-[2-[4-[4-(4-methoxybenzoyl)piperazin-1-yl]anilino]-2-oxoethyl]-N-(2-methoxyethyl)cyclopentanecarboxamide |
| SMILES | COCCN(CC(=O)Nc1ccc(N2CCN(C(=O)c3ccc(OC)cc3)CC2)cc1)C(=O)C1CCCC1 |
| InChI | InChI=1S/C29H38N4O5/c1-37-20-19-33(29(36)22-5-3-4-6-22)21-27(34)30-24-9-11-25(12-10-24)31-15-17-32(18-16-31)28(35)23-7-13-26(38-2)14-8-23/h7-14,22H,3-6,15-21H2,1-2H3,(H,30,34) |
| InChIKey | DPDTYHVZEIRSGC-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 91.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.65 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|