C35H35FN4O4 — CID 42676324
N-[(4-fluorophenyl)methyl]-4-methoxy-N-[2-[4-[4-(4-methylbenzoyl)piperazin-1-yl]anilino]-2-oxoethyl]benzamide (PubChem CID 42676324) has the molecular formula C35H35FN4O4 and a molecular weight of 594.69 g/mol. Its IUPAC name is N-[(4-fluorophenyl)methyl]-4-methoxy-N-[2-[4-[4-(4-methylbenzoyl)piperazin-1-yl]anilino]-2-oxoethyl]benzamide.
| Compound Name | N-[(4-fluorophenyl)methyl]-4-methoxy-N-[2-[4-[4-(4-methylbenzoyl)piperazin-1-yl]anilino]-2-oxoethyl]benzamide |
|---|---|
| PubChem CID | 42676324 |
| Molecular Formula | C35H35FN4O4 |
| Molecular Weight | 594.69 g/mol |
| Exact Mass | 594.26 |
| IUPAC Name | N-[(4-fluorophenyl)methyl]-4-methoxy-N-[2-[4-[4-(4-methylbenzoyl)piperazin-1-yl]anilino]-2-oxoethyl]benzamide |
| SMILES | COc1ccc(C(=O)N(CC(=O)Nc2ccc(N3CCN(C(=O)c4ccc(C)cc4)CC3)cc2)Cc2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C35H35FN4O4/c1-25-3-7-27(8-4-25)34(42)39-21-19-38(20-22-39)31-15-13-30(14-16-31)37-33(41)24-40(23-26-5-11-29(36)12-6-26)35(43)28-9-17-32(44-2)18-10-28/h3-18H,19-24H2,1-2H3,(H,37,41) |
| InChIKey | HKHDVBKGUJXOQI-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 82.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.69 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|