C31H37N5O4 — CID 42677224
4-[4-[[2-[(4-methoxybenzoyl)-propylamino]acetyl]amino]phenyl]-N-(4-methylphenyl)piperazine-1-carboxamide (PubChem CID 42677224) has the molecular formula C31H37N5O4 and a molecular weight of 543.67 g/mol. Its IUPAC name is 4-[4-[[2-[(4-methoxybenzoyl)-propylamino]acetyl]amino]phenyl]-N-(4-methylphenyl)piperazine-1-carboxamide.
| Compound Name | 4-[4-[[2-[(4-methoxybenzoyl)-propylamino]acetyl]amino]phenyl]-N-(4-methylphenyl)piperazine-1-carboxamide |
|---|---|
| PubChem CID | 42677224 |
| Molecular Formula | C31H37N5O4 |
| Molecular Weight | 543.67 g/mol |
| Exact Mass | 543.28 |
| IUPAC Name | 4-[4-[[2-[(4-methoxybenzoyl)-propylamino]acetyl]amino]phenyl]-N-(4-methylphenyl)piperazine-1-carboxamide |
| SMILES | CCCN(CC(=O)Nc1ccc(N2CCN(C(=O)Nc3ccc(C)cc3)CC2)cc1)C(=O)c1ccc(OC)cc1 |
| InChI | InChI=1S/C31H37N5O4/c1-4-17-36(30(38)24-7-15-28(40-3)16-8-24)22-29(37)32-25-11-13-27(14-12-25)34-18-20-35(21-19-34)31(39)33-26-9-5-23(2)6-10-26/h5-16H,4,17-22H2,1-3H3,(H,32,37)(H,33,39) |
| InChIKey | ZDKXAZLSBYWAIW-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 94.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.67 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|