C26H34FN5O4 — CID 42676781
N-[4-[4-(2-fluorobenzoyl)piperazin-1-yl]phenyl]-2-[2-methoxyethyl(propan-2-ylcarbamoyl)amino]acetamide (PubChem CID 42676781) has the molecular formula C26H34FN5O4 and a molecular weight of 499.59 g/mol. Its IUPAC name is N-[4-[4-(2-fluorobenzoyl)piperazin-1-yl]phenyl]-2-[2-methoxyethyl(propan-2-ylcarbamoyl)amino]acetamide.
| Compound Name | N-[4-[4-(2-fluorobenzoyl)piperazin-1-yl]phenyl]-2-[2-methoxyethyl(propan-2-ylcarbamoyl)amino]acetamide |
|---|---|
| PubChem CID | 42676781 |
| Molecular Formula | C26H34FN5O4 |
| Molecular Weight | 499.59 g/mol |
| Exact Mass | 499.26 |
| IUPAC Name | N-[4-[4-(2-fluorobenzoyl)piperazin-1-yl]phenyl]-2-[2-methoxyethyl(propan-2-ylcarbamoyl)amino]acetamide |
| SMILES | COCCN(CC(=O)Nc1ccc(N2CCN(C(=O)c3ccccc3F)CC2)cc1)C(=O)NC(C)C |
| InChI | InChI=1S/C26H34FN5O4/c1-19(2)28-26(35)32(16-17-36-3)18-24(33)29-20-8-10-21(11-9-20)30-12-14-31(15-13-30)25(34)22-6-4-5-7-23(22)27/h4-11,19H,12-18H2,1-3H3,(H,28,35)(H,29,33) |
| InChIKey | LWHCYHDWDVEYLJ-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 94.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.59 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|