C30H31FN4O4 — CID 42676227
2-fluoro-N-[2-[4-[4-(4-methoxybenzoyl)piperazin-1-yl]anilino]-2-oxoethyl]-N-prop-2-enylbenzamide (PubChem CID 42676227) has the molecular formula C30H31FN4O4 and a molecular weight of 530.60 g/mol. Its IUPAC name is 2-fluoro-N-[2-[4-[4-(4-methoxybenzoyl)piperazin-1-yl]anilino]-2-oxoethyl]-N-prop-2-enylbenzamide.
| Compound Name | 2-fluoro-N-[2-[4-[4-(4-methoxybenzoyl)piperazin-1-yl]anilino]-2-oxoethyl]-N-prop-2-enylbenzamide |
|---|---|
| PubChem CID | 42676227 |
| Molecular Formula | C30H31FN4O4 |
| Molecular Weight | 530.60 g/mol |
| Exact Mass | 530.23 |
| IUPAC Name | 2-fluoro-N-[2-[4-[4-(4-methoxybenzoyl)piperazin-1-yl]anilino]-2-oxoethyl]-N-prop-2-enylbenzamide |
| SMILES | C=CCN(CC(=O)Nc1ccc(N2CCN(C(=O)c3ccc(OC)cc3)CC2)cc1)C(=O)c1ccccc1F |
| InChI | InChI=1S/C30H31FN4O4/c1-3-16-35(30(38)26-6-4-5-7-27(26)31)21-28(36)32-23-10-12-24(13-11-23)33-17-19-34(20-18-33)29(37)22-8-14-25(39-2)15-9-22/h3-15H,1,16-21H2,2H3,(H,32,36) |
| InChIKey | GSBSGFKXIXBYDY-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 82.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.60 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|