C30H32FN5O4 — CID 42676678
N-(2-fluorophenyl)-4-[4-[[2-[(3-methoxybenzoyl)-prop-2-enylamino]acetyl]amino]phenyl]piperazine-1-carboxamide (PubChem CID 42676678) has the molecular formula C30H32FN5O4 and a molecular weight of 545.62 g/mol. Its IUPAC name is N-(2-fluorophenyl)-4-[4-[[2-[(3-methoxybenzoyl)-prop-2-enylamino]acetyl]amino]phenyl]piperazine-1-carboxamide.
| Compound Name | N-(2-fluorophenyl)-4-[4-[[2-[(3-methoxybenzoyl)-prop-2-enylamino]acetyl]amino]phenyl]piperazine-1-carboxamide |
|---|---|
| PubChem CID | 42676678 |
| Molecular Formula | C30H32FN5O4 |
| Molecular Weight | 545.62 g/mol |
| Exact Mass | 545.24 |
| IUPAC Name | N-(2-fluorophenyl)-4-[4-[[2-[(3-methoxybenzoyl)-prop-2-enylamino]acetyl]amino]phenyl]piperazine-1-carboxamide |
| SMILES | C=CCN(CC(=O)Nc1ccc(N2CCN(C(=O)Nc3ccccc3F)CC2)cc1)C(=O)c1cccc(OC)c1 |
| InChI | InChI=1S/C30H32FN5O4/c1-3-15-36(29(38)22-7-6-8-25(20-22)40-2)21-28(37)32-23-11-13-24(14-12-23)34-16-18-35(19-17-34)30(39)33-27-10-5-4-9-26(27)31/h3-14,20H,1,15-19,21H2,2H3,(H,32,37)(H,33,39) |
| InChIKey | GFDIUECZKAWLON-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 94.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.62 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|