C19H23FN4O — CID 113112737
4-[4-(dimethylamino)phenyl]-N-(2-fluorophenyl)piperazine-1-carboxamide (PubChem CID 113112737) has the molecular formula C19H23FN4O and a molecular weight of 342.42 g/mol. Its IUPAC name is 4-[4-(dimethylamino)phenyl]-N-(2-fluorophenyl)piperazine-1-carboxamide.
| Compound Name | 4-[4-(dimethylamino)phenyl]-N-(2-fluorophenyl)piperazine-1-carboxamide |
|---|---|
| PubChem CID | 113112737 |
| Molecular Formula | C19H23FN4O |
| Molecular Weight | 342.42 g/mol |
| Exact Mass | 342.19 |
| IUPAC Name | 4-[4-(dimethylamino)phenyl]-N-(2-fluorophenyl)piperazine-1-carboxamide |
| SMILES | CN(C)c1ccc(N2CCN(C(=O)Nc3ccccc3F)CC2)cc1 |
| InChI | InChI=1S/C19H23FN4O/c1-22(2)15-7-9-16(10-8-15)23-11-13-24(14-12-23)19(25)21-18-6-4-3-5-17(18)20/h3-10H,11-14H2,1-2H3,(H,21,25) |
| InChIKey | HGCDHBPUSULGHY-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 38.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.42 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|