C17H16F3N3O — CID 113112770
4-(3,4-difluorophenyl)-N-(2-fluorophenyl)piperazine-1-carboxamide (PubChem CID 113112770) has the molecular formula C17H16F3N3O and a molecular weight of 335.33 g/mol. Its IUPAC name is 4-(3,4-difluorophenyl)-N-(2-fluorophenyl)piperazine-1-carboxamide.
| Compound Name | 4-(3,4-difluorophenyl)-N-(2-fluorophenyl)piperazine-1-carboxamide |
|---|---|
| PubChem CID | 113112770 |
| Molecular Formula | C17H16F3N3O |
| Molecular Weight | 335.33 g/mol |
| Exact Mass | 335.12 |
| IUPAC Name | 4-(3,4-difluorophenyl)-N-(2-fluorophenyl)piperazine-1-carboxamide |
| SMILES | O=C(Nc1ccccc1F)N1CCN(c2ccc(F)c(F)c2)CC1 |
| InChI | InChI=1S/C17H16F3N3O/c18-13-6-5-12(11-15(13)20)22-7-9-23(10-8-22)17(24)21-16-4-2-1-3-14(16)19/h1-6,11H,7-10H2,(H,21,24) |
| InChIKey | RNAPCZOBMXDYLT-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.33 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |