C21H26N4O3 — CID 113114384
methyl 4-[[4-[4-(dimethylamino)phenyl]piperazine-1-carbonyl]amino]benzoate (PubChem CID 113114384) has the molecular formula C21H26N4O3 and a molecular weight of 382.46 g/mol. Its IUPAC name is methyl 4-[[4-[4-(dimethylamino)phenyl]piperazine-1-carbonyl]amino]benzoate.
| Compound Name | methyl 4-[[4-[4-(dimethylamino)phenyl]piperazine-1-carbonyl]amino]benzoate |
|---|---|
| PubChem CID | 113114384 |
| Molecular Formula | C21H26N4O3 |
| Molecular Weight | 382.46 g/mol |
| Exact Mass | 382.20 |
| IUPAC Name | methyl 4-[[4-[4-(dimethylamino)phenyl]piperazine-1-carbonyl]amino]benzoate |
| SMILES | COC(=O)c1ccc(NC(=O)N2CCN(c3ccc(N(C)C)cc3)CC2)cc1 |
| InChI | InChI=1S/C21H26N4O3/c1-23(2)18-8-10-19(11-9-18)24-12-14-25(15-13-24)21(27)22-17-6-4-16(5-7-17)20(26)28-3/h4-11H,12-15H2,1-3H3,(H,22,27) |
| InChIKey | BJHCENXGLICMJV-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 65.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.46 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|