C19H19F2N3O3 — CID 113114382
methyl 4-[4-[(3,4-difluorophenyl)carbamoyl]piperazin-1-yl]benzoate (PubChem CID 113114382) has the molecular formula C19H19F2N3O3 and a molecular weight of 375.38 g/mol. Its IUPAC name is methyl 4-[4-[(3,4-difluorophenyl)carbamoyl]piperazin-1-yl]benzoate.
| Compound Name | methyl 4-[4-[(3,4-difluorophenyl)carbamoyl]piperazin-1-yl]benzoate |
|---|---|
| PubChem CID | 113114382 |
| Molecular Formula | C19H19F2N3O3 |
| Molecular Weight | 375.38 g/mol |
| Exact Mass | 375.14 |
| IUPAC Name | methyl 4-[4-[(3,4-difluorophenyl)carbamoyl]piperazin-1-yl]benzoate |
| SMILES | COC(=O)c1ccc(N2CCN(C(=O)Nc3ccc(F)c(F)c3)CC2)cc1 |
| InChI | InChI=1S/C19H19F2N3O3/c1-27-18(25)13-2-5-15(6-3-13)23-8-10-24(11-9-23)19(26)22-14-4-7-16(20)17(21)12-14/h2-7,12H,8-11H2,1H3,(H,22,26) |
| InChIKey | QOEUZYCYLBTRFD-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.38 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |