C19H22Cl2N4O — CID 113114419
N-(2,4-dichlorophenyl)-4-[4-(dimethylamino)phenyl]piperazine-1-carboxamide (PubChem CID 113114419) has the molecular formula C19H22Cl2N4O and a molecular weight of 393.32 g/mol. Its IUPAC name is N-(2,4-dichlorophenyl)-4-[4-(dimethylamino)phenyl]piperazine-1-carboxamide.
| Compound Name | N-(2,4-dichlorophenyl)-4-[4-(dimethylamino)phenyl]piperazine-1-carboxamide |
|---|---|
| PubChem CID | 113114419 |
| Molecular Formula | C19H22Cl2N4O |
| Molecular Weight | 393.32 g/mol |
| Exact Mass | 392.12 |
| IUPAC Name | N-(2,4-dichlorophenyl)-4-[4-(dimethylamino)phenyl]piperazine-1-carboxamide |
| SMILES | CN(C)c1ccc(N2CCN(C(=O)Nc3ccc(Cl)cc3Cl)CC2)cc1 |
| InChI | InChI=1S/C19H22Cl2N4O/c1-23(2)15-4-6-16(7-5-15)24-9-11-25(12-10-24)19(26)22-18-8-3-14(20)13-17(18)21/h3-8,13H,9-12H2,1-2H3,(H,22,26) |
| InChIKey | IEWMJPXTIFGHSD-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 38.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.32 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|