C29H31ClFN5O3 — CID 83272882
4-[4-[[2-[(2-chlorobenzoyl)-propan-2-ylamino]acetyl]amino]phenyl]-N-(2-fluorophenyl)piperazine-1-carboxamide (PubChem CID 83272882) has the molecular formula C29H31ClFN5O3 and a molecular weight of 552.05 g/mol. Its IUPAC name is 4-[4-[[2-[(2-chlorobenzoyl)-propan-2-ylamino]acetyl]amino]phenyl]-N-(2-fluorophenyl)piperazine-1-carboxamide.
| Compound Name | 4-[4-[[2-[(2-chlorobenzoyl)-propan-2-ylamino]acetyl]amino]phenyl]-N-(2-fluorophenyl)piperazine-1-carboxamide |
|---|---|
| PubChem CID | 83272882 |
| Molecular Formula | C29H31ClFN5O3 |
| Molecular Weight | 552.05 g/mol |
| Exact Mass | 551.21 |
| IUPAC Name | 4-[4-[[2-[(2-chlorobenzoyl)-propan-2-ylamino]acetyl]amino]phenyl]-N-(2-fluorophenyl)piperazine-1-carboxamide |
| SMILES | CC(C)N(CC(=O)Nc1ccc(N2CCN(C(=O)Nc3ccccc3F)CC2)cc1)C(=O)c1ccccc1Cl |
| InChI | InChI=1S/C29H31ClFN5O3/c1-20(2)36(28(38)23-7-3-4-8-24(23)30)19-27(37)32-21-11-13-22(14-12-21)34-15-17-35(18-16-34)29(39)33-26-10-6-5-9-25(26)31/h3-14,20H,15-19H2,1-2H3,(H,32,37)(H,33,39) |
| InChIKey | CBJAJHQBOUWAGX-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 84.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.05 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|