C33H32F2N4O4S — CID 42676849
N-[4-[4-(2-fluorobenzoyl)piperazin-1-yl]phenyl]-2-[(4-fluorophenyl)methyl-(4-methylphenyl)sulfonylamino]acetamide (PubChem CID 42676849) has the molecular formula C33H32F2N4O4S and a molecular weight of 618.71 g/mol. Its IUPAC name is N-[4-[4-(2-fluorobenzoyl)piperazin-1-yl]phenyl]-2-[(4-fluorophenyl)methyl-(4-methylphenyl)sulfonylamino]acetamide.
| Compound Name | N-[4-[4-(2-fluorobenzoyl)piperazin-1-yl]phenyl]-2-[(4-fluorophenyl)methyl-(4-methylphenyl)sulfonylamino]acetamide |
|---|---|
| PubChem CID | 42676849 |
| Molecular Formula | C33H32F2N4O4S |
| Molecular Weight | 618.71 g/mol |
| Exact Mass | 618.21 |
| IUPAC Name | N-[4-[4-(2-fluorobenzoyl)piperazin-1-yl]phenyl]-2-[(4-fluorophenyl)methyl-(4-methylphenyl)sulfonylamino]acetamide |
| SMILES | Cc1ccc(S(=O)(=O)N(CC(=O)Nc2ccc(N3CCN(C(=O)c4ccccc4F)CC3)cc2)Cc2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C33H32F2N4O4S/c1-24-6-16-29(17-7-24)44(42,43)39(22-25-8-10-26(34)11-9-25)23-32(40)36-27-12-14-28(15-13-27)37-18-20-38(21-19-37)33(41)30-4-2-3-5-31(30)35/h2-17H,18-23H2,1H3,(H,36,40) |
| InChIKey | PSVCVVVKOMXGDT-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 90.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.71 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|