C19H15ClN2O4 — CID 2100384
2-(4-chlorophenyl)-5-(morpholine-4-carbonyl)isoindole-1,3-dione (PubChem CID 2100384) has the molecular formula C19H15ClN2O4 and a molecular weight of 370.79 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-5-(morpholine-4-carbonyl)isoindole-1,3-dione.
| Compound Name | 2-(4-chlorophenyl)-5-(morpholine-4-carbonyl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 2100384 |
| Molecular Formula | C19H15ClN2O4 |
| Molecular Weight | 370.79 g/mol |
| Exact Mass | 370.07 |
| IUPAC Name | 2-(4-chlorophenyl)-5-(morpholine-4-carbonyl)isoindole-1,3-dione |
| SMILES | O=C(c1ccc2c(c1)C(=O)N(c1ccc(Cl)cc1)C2=O)N1CCOCC1 |
| InChI | InChI=1S/C19H15ClN2O4/c20-13-2-4-14(5-3-13)22-18(24)15-6-1-12(11-16(15)19(22)25)17(23)21-7-9-26-10-8-21/h1-6,11H,7-10H2 |
| InChIKey | ZNWFJWRFRNGRNA-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.79 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|