C22H19ClN2O6 — CID 16506175
(1-morpholin-4-yl-1-oxopropan-2-yl) 2-(4-chlorophenyl)-1,3-dioxoisoindole-5-carboxylate (PubChem CID 16506175) has the molecular formula C22H19ClN2O6 and a molecular weight of 442.86 g/mol. Its IUPAC name is (1-morpholin-4-yl-1-oxopropan-2-yl) 2-(4-chlorophenyl)-1,3-dioxoisoindole-5-carboxylate.
| Compound Name | (1-morpholin-4-yl-1-oxopropan-2-yl) 2-(4-chlorophenyl)-1,3-dioxoisoindole-5-carboxylate |
|---|---|
| PubChem CID | 16506175 |
| Molecular Formula | C22H19ClN2O6 |
| Molecular Weight | 442.86 g/mol |
| Exact Mass | 442.09 |
| IUPAC Name | (1-morpholin-4-yl-1-oxopropan-2-yl) 2-(4-chlorophenyl)-1,3-dioxoisoindole-5-carboxylate |
| SMILES | CC(OC(=O)c1ccc2c(c1)C(=O)N(c1ccc(Cl)cc1)C2=O)C(=O)N1CCOCC1 |
| InChI | InChI=1S/C22H19ClN2O6/c1-13(19(26)24-8-10-30-11-9-24)31-22(29)14-2-7-17-18(12-14)21(28)25(20(17)27)16-5-3-15(23)4-6-16/h2-7,12-13H,8-11H2,1H3 |
| InChIKey | LNZUDKASJNTDCX-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 93.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.86 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|