C26H27N3O7 — CID 55304985
[1-(2,6-dimethylmorpholin-4-yl)-1-oxopropan-2-yl] 2-(4-acetamidophenyl)-1,3-dioxoisoindole-5-carboxylate (PubChem CID 55304985) has the molecular formula C26H27N3O7 and a molecular weight of 493.52 g/mol. Its IUPAC name is [1-(2,6-dimethylmorpholin-4-yl)-1-oxopropan-2-yl] 2-(4-acetamidophenyl)-1,3-dioxoisoindole-5-carboxylate.
| Compound Name | [1-(2,6-dimethylmorpholin-4-yl)-1-oxopropan-2-yl] 2-(4-acetamidophenyl)-1,3-dioxoisoindole-5-carboxylate |
|---|---|
| PubChem CID | 55304985 |
| Molecular Formula | C26H27N3O7 |
| Molecular Weight | 493.52 g/mol |
| Exact Mass | 493.18 |
| IUPAC Name | [1-(2,6-dimethylmorpholin-4-yl)-1-oxopropan-2-yl] 2-(4-acetamidophenyl)-1,3-dioxoisoindole-5-carboxylate |
| SMILES | CC(=O)Nc1ccc(N2C(=O)c3ccc(C(=O)OC(C)C(=O)N4CC(C)OC(C)C4)cc3C2=O)cc1 |
| InChI | InChI=1S/C26H27N3O7/c1-14-12-28(13-15(2)35-14)23(31)16(3)36-26(34)18-5-10-21-22(11-18)25(33)29(24(21)32)20-8-6-19(7-9-20)27-17(4)30/h5-11,14-16H,12-13H2,1-4H3,(H,27,30) |
| InChIKey | UNYKXWHQXGMOES-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 122.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.52 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|