C27H24N2O7 — CID 43014853
[1-(4-methoxyanilino)-1-oxopropan-2-yl] 2-(4-ethoxyphenyl)-1,3-dioxoisoindole-5-carboxylate (PubChem CID 43014853) has the molecular formula C27H24N2O7 and a molecular weight of 488.50 g/mol. Its IUPAC name is [1-(4-methoxyanilino)-1-oxopropan-2-yl] 2-(4-ethoxyphenyl)-1,3-dioxoisoindole-5-carboxylate.
| Compound Name | [1-(4-methoxyanilino)-1-oxopropan-2-yl] 2-(4-ethoxyphenyl)-1,3-dioxoisoindole-5-carboxylate |
|---|---|
| PubChem CID | 43014853 |
| Molecular Formula | C27H24N2O7 |
| Molecular Weight | 488.50 g/mol |
| Exact Mass | 488.16 |
| IUPAC Name | [1-(4-methoxyanilino)-1-oxopropan-2-yl] 2-(4-ethoxyphenyl)-1,3-dioxoisoindole-5-carboxylate |
| SMILES | CCOc1ccc(N2C(=O)c3ccc(C(=O)OC(C)C(=O)Nc4ccc(OC)cc4)cc3C2=O)cc1 |
| InChI | InChI=1S/C27H24N2O7/c1-4-35-21-12-8-19(9-13-21)29-25(31)22-14-5-17(15-23(22)26(29)32)27(33)36-16(2)24(30)28-18-6-10-20(34-3)11-7-18/h5-16H,4H2,1-3H3,(H,28,30) |
| InChIKey | JVCULFJLVCXQSE-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 111.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.50 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|