C26H21FN2O6 — CID 46621993
[1-(3-fluoroanilino)-1-oxopropan-2-yl] 2-(4-ethoxyphenyl)-1,3-dioxoisoindole-5-carboxylate (PubChem CID 46621993) has the molecular formula C26H21FN2O6 and a molecular weight of 476.46 g/mol. Its IUPAC name is [1-(3-fluoroanilino)-1-oxopropan-2-yl] 2-(4-ethoxyphenyl)-1,3-dioxoisoindole-5-carboxylate.
| Compound Name | [1-(3-fluoroanilino)-1-oxopropan-2-yl] 2-(4-ethoxyphenyl)-1,3-dioxoisoindole-5-carboxylate |
|---|---|
| PubChem CID | 46621993 |
| Molecular Formula | C26H21FN2O6 |
| Molecular Weight | 476.46 g/mol |
| Exact Mass | 476.14 |
| IUPAC Name | [1-(3-fluoroanilino)-1-oxopropan-2-yl] 2-(4-ethoxyphenyl)-1,3-dioxoisoindole-5-carboxylate |
| SMILES | CCOc1ccc(N2C(=O)c3ccc(C(=O)OC(C)C(=O)Nc4cccc(F)c4)cc3C2=O)cc1 |
| InChI | InChI=1S/C26H21FN2O6/c1-3-34-20-10-8-19(9-11-20)29-24(31)21-12-7-16(13-22(21)25(29)32)26(33)35-15(2)23(30)28-18-6-4-5-17(27)14-18/h4-15H,3H2,1-2H3,(H,28,30) |
| InChIKey | YXAHLBUDYHOGCZ-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.46 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|