C26H24N4O5 — CID 55962953
N-[1-[4-(carbamoylamino)phenyl]ethyl]-2-(4-ethoxyphenyl)-1,3-dioxoisoindole-5-carboxamide (PubChem CID 55962953) has the molecular formula C26H24N4O5 and a molecular weight of 472.50 g/mol. Its IUPAC name is N-[1-[4-(carbamoylamino)phenyl]ethyl]-2-(4-ethoxyphenyl)-1,3-dioxoisoindole-5-carboxamide.
| Compound Name | N-[1-[4-(carbamoylamino)phenyl]ethyl]-2-(4-ethoxyphenyl)-1,3-dioxoisoindole-5-carboxamide |
|---|---|
| PubChem CID | 55962953 |
| Molecular Formula | C26H24N4O5 |
| Molecular Weight | 472.50 g/mol |
| Exact Mass | 472.17 |
| IUPAC Name | N-[1-[4-(carbamoylamino)phenyl]ethyl]-2-(4-ethoxyphenyl)-1,3-dioxoisoindole-5-carboxamide |
| SMILES | CCOc1ccc(N2C(=O)c3ccc(C(=O)NC(C)c4ccc(NC(N)=O)cc4)cc3C2=O)cc1 |
| InChI | InChI=1S/C26H24N4O5/c1-3-35-20-11-9-19(10-12-20)30-24(32)21-13-6-17(14-22(21)25(30)33)23(31)28-15(2)16-4-7-18(8-5-16)29-26(27)34/h4-15H,3H2,1-2H3,(H,28,31)(H3,27,29,34) |
| InChIKey | UBSNOZHBLQMFPM-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 130.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.50 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|