C23H14ClNO5 — CID 4010022
(4-chlorophenyl) 2-(4-acetylphenyl)-1,3-dioxoisoindole-5-carboxylate (PubChem CID 4010022) has the molecular formula C23H14ClNO5 and a molecular weight of 419.82 g/mol. Its IUPAC name is (4-chlorophenyl) 2-(4-acetylphenyl)-1,3-dioxoisoindole-5-carboxylate.
| Compound Name | (4-chlorophenyl) 2-(4-acetylphenyl)-1,3-dioxoisoindole-5-carboxylate |
|---|---|
| PubChem CID | 4010022 |
| Molecular Formula | C23H14ClNO5 |
| Molecular Weight | 419.82 g/mol |
| Exact Mass | 419.06 |
| IUPAC Name | (4-chlorophenyl) 2-(4-acetylphenyl)-1,3-dioxoisoindole-5-carboxylate |
| SMILES | CC(=O)c1ccc(N2C(=O)c3ccc(C(=O)Oc4ccc(Cl)cc4)cc3C2=O)cc1 |
| InChI | InChI=1S/C23H14ClNO5/c1-13(26)14-2-7-17(8-3-14)25-21(27)19-11-4-15(12-20(19)22(25)28)23(29)30-18-9-5-16(24)6-10-18/h2-12H,1H3 |
| InChIKey | FPCYCSATLLKMFM-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.82 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|