C45H26F6N4O8 — CID 159247499
(4-aminophenyl) 2-[4-[2-[4-[5-(4-aminophenoxy)carbonyl-1,3-dioxoisoindol-2-yl]phenyl]-1,1,1,3,3,3-hexafluoropropan-2-yl]phenyl]-1,3-dioxoisoindole-5-carboxylate (PubChem CID 159247499) has the molecular formula C45H26F6N4O8 and a molecular weight of 864.71 g/mol. Its IUPAC name is (4-aminophenyl) 2-[4-[2-[4-[5-(4-aminophenoxy)carbonyl-1,3-dioxoisoindol-2-yl]phenyl]-1,1,1,3,3,3-hexafluoropropan-2-yl]phenyl]-1,3-dioxoisoindole-5-carboxylate.
| Compound Name | (4-aminophenyl) 2-[4-[2-[4-[5-(4-aminophenoxy)carbonyl-1,3-dioxoisoindol-2-yl]phenyl]-1,1,1,3,3,3-hexafluoropropan-2-yl]phenyl]-1,3-dioxoisoindole-5-carboxylate |
|---|---|
| PubChem CID | 159247499 |
| Molecular Formula | C45H26F6N4O8 |
| Molecular Weight | 864.71 g/mol |
| Exact Mass | 864.17 |
| IUPAC Name | (4-aminophenyl) 2-[4-[2-[4-[5-(4-aminophenoxy)carbonyl-1,3-dioxoisoindol-2-yl]phenyl]-1,1,1,3,3,3-hexafluoropropan-2-yl]phenyl]-1,3-dioxoisoindole-5-carboxylate |
| SMILES | Nc1ccc(OC(=O)c2ccc3c(c2)C(=O)N(c2ccc(C(c4ccc(N5C(=O)c6ccc(C(=O)Oc7ccc(N)cc7)cc6C5=O)cc4)(C(F)(F)F)C(F)(F)F)cc2)C3=O)cc1 |
| InChI | InChI=1S/C45H26F6N4O8/c46-44(47,48)43(45(49,50)51,25-3-11-29(12-4-25)54-37(56)33-19-1-23(21-35(33)39(54)58)41(60)62-31-15-7-27(52)8-16-31)26-5-13-30(14-6-26)55-38(57)34-20-2-24(22-36(34)40(55)59)42(61)63-32-17-9-28(53)10-18-32/h1-22H,52-53H2 |
| InChIKey | NDWWTSCPILZKIP-UHFFFAOYSA-N |
| XLogP | 8.30 |
| TPSA | 179.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 63 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 864.71 |
| LogP ≤ 5 | 8.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|