C26H18F6N2O3 — CID 58363770
2-[4-[1,1,1,3,3,3-hexafluoro-2-(4-methylphenyl)propan-2-yl]phenyl]-N-methyl-1,3-dioxoisoindole-5-carboxamide (PubChem CID 58363770) has the molecular formula C26H18F6N2O3 and a molecular weight of 520.43 g/mol. Its IUPAC name is 2-[4-[1,1,1,3,3,3-hexafluoro-2-(4-methylphenyl)propan-2-yl]phenyl]-N-methyl-1,3-dioxoisoindole-5-carboxamide.
| Compound Name | 2-[4-[1,1,1,3,3,3-hexafluoro-2-(4-methylphenyl)propan-2-yl]phenyl]-N-methyl-1,3-dioxoisoindole-5-carboxamide |
|---|---|
| PubChem CID | 58363770 |
| Molecular Formula | C26H18F6N2O3 |
| Molecular Weight | 520.43 g/mol |
| Exact Mass | 520.12 |
| IUPAC Name | 2-[4-[1,1,1,3,3,3-hexafluoro-2-(4-methylphenyl)propan-2-yl]phenyl]-N-methyl-1,3-dioxoisoindole-5-carboxamide |
| SMILES | CNC(=O)c1ccc2c(c1)C(=O)N(c1ccc(C(c3ccc(C)cc3)(C(F)(F)F)C(F)(F)F)cc1)C2=O |
| InChI | InChI=1S/C26H18F6N2O3/c1-14-3-6-16(7-4-14)24(25(27,28)29,26(30,31)32)17-8-10-18(11-9-17)34-22(36)19-12-5-15(21(35)33-2)13-20(19)23(34)37/h3-13H,1-2H3,(H,33,35) |
| InChIKey | HUGRWSCXUSDPJT-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.43 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|