C31H14F8N2O4 — CID 2832096
2-(4-fluorophenyl)-5-[1,1,1,3,3,3-hexafluoro-2-[2-(4-fluorophenyl)-1,3-dioxoisoindol-5-yl]propan-2-yl]isoindole-1,3-dione (PubChem CID 2832096) has the molecular formula C31H14F8N2O4 and a molecular weight of 630.45 g/mol. Its IUPAC name is 2-(4-fluorophenyl)-5-[1,1,1,3,3,3-hexafluoro-2-[2-(4-fluorophenyl)-1,3-dioxoisoindol-5-yl]propan-2-yl]isoindole-1,3-dione.
| Compound Name | 2-(4-fluorophenyl)-5-[1,1,1,3,3,3-hexafluoro-2-[2-(4-fluorophenyl)-1,3-dioxoisoindol-5-yl]propan-2-yl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 2832096 |
| Molecular Formula | C31H14F8N2O4 |
| Molecular Weight | 630.45 g/mol |
| Exact Mass | 630.08 |
| IUPAC Name | 2-(4-fluorophenyl)-5-[1,1,1,3,3,3-hexafluoro-2-[2-(4-fluorophenyl)-1,3-dioxoisoindol-5-yl]propan-2-yl]isoindole-1,3-dione |
| SMILES | O=C1c2ccc(C(c3ccc4c(c3)C(=O)N(c3ccc(F)cc3)C4=O)(C(F)(F)F)C(F)(F)F)cc2C(=O)N1c1ccc(F)cc1 |
| InChI | InChI=1S/C31H14F8N2O4/c32-17-3-7-19(8-4-17)40-25(42)21-11-1-15(13-23(21)27(40)44)29(30(34,35)36,31(37,38)39)16-2-12-22-24(14-16)28(45)41(26(22)43)20-9-5-18(33)6-10-20/h1-14H |
| InChIKey | FBNGJCSCUIMSOY-UHFFFAOYSA-N |
| XLogP | 6.98 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.45 |
| LogP ≤ 5 | 6.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|