C37H20F6N2O6 — CID 157247082
5-[2-[1,3-dioxo-2-(4-prop-2-ynoxyphenyl)isoindol-5-yl]-1,1,1,3,3,3-hexafluoropropan-2-yl]-2-(4-prop-2-ynoxyphenyl)isoindole-1,3-dione (PubChem CID 157247082) has the molecular formula C37H20F6N2O6 and a molecular weight of 702.56 g/mol. Its IUPAC name is 5-[2-[1,3-dioxo-2-(4-prop-2-ynoxyphenyl)isoindol-5-yl]-1,1,1,3,3,3-hexafluoropropan-2-yl]-2-(4-prop-2-ynoxyphenyl)isoindole-1,3-dione.
| Compound Name | 5-[2-[1,3-dioxo-2-(4-prop-2-ynoxyphenyl)isoindol-5-yl]-1,1,1,3,3,3-hexafluoropropan-2-yl]-2-(4-prop-2-ynoxyphenyl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 157247082 |
| Molecular Formula | C37H20F6N2O6 |
| Molecular Weight | 702.56 g/mol |
| Exact Mass | 702.12 |
| IUPAC Name | 5-[2-[1,3-dioxo-2-(4-prop-2-ynoxyphenyl)isoindol-5-yl]-1,1,1,3,3,3-hexafluoropropan-2-yl]-2-(4-prop-2-ynoxyphenyl)isoindole-1,3-dione |
| SMILES | C#CCOc1ccc(N2C(=O)c3ccc(C(c4ccc5c(c4)C(=O)N(c4ccc(OCC#C)cc4)C5=O)(C(F)(F)F)C(F)(F)F)cc3C2=O)cc1 |
| InChI | InChI=1S/C37H20F6N2O6/c1-3-17-50-25-11-7-23(8-12-25)44-31(46)27-15-5-21(19-29(27)33(44)48)35(36(38,39)40,37(41,42)43)22-6-16-28-30(20-22)34(49)45(32(28)47)24-9-13-26(14-10-24)51-18-4-2/h1-2,5-16,19-20H,17-18H2 |
| InChIKey | IKZLSFAMRYLWGL-UHFFFAOYSA-N |
| XLogP | 6.72 |
| TPSA | 93.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 702.56 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|