C31H16F8N4O4 — CID 139771855
2-(3-amino-4-fluorophenyl)-5-[2-[2-(3-amino-4-fluorophenyl)-1,3-dioxoisoindol-5-yl]-1,1,1,3,3,3-hexafluoropropan-2-yl]isoindole-1,3-dione (PubChem CID 139771855) has the molecular formula C31H16F8N4O4 and a molecular weight of 660.48 g/mol. Its IUPAC name is 2-(3-amino-4-fluorophenyl)-5-[2-[2-(3-amino-4-fluorophenyl)-1,3-dioxoisoindol-5-yl]-1,1,1,3,3,3-hexafluoropropan-2-yl]isoindole-1,3-dione.
| Compound Name | 2-(3-amino-4-fluorophenyl)-5-[2-[2-(3-amino-4-fluorophenyl)-1,3-dioxoisoindol-5-yl]-1,1,1,3,3,3-hexafluoropropan-2-yl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 139771855 |
| Molecular Formula | C31H16F8N4O4 |
| Molecular Weight | 660.48 g/mol |
| Exact Mass | 660.10 |
| IUPAC Name | 2-(3-amino-4-fluorophenyl)-5-[2-[2-(3-amino-4-fluorophenyl)-1,3-dioxoisoindol-5-yl]-1,1,1,3,3,3-hexafluoropropan-2-yl]isoindole-1,3-dione |
| SMILES | Nc1cc(N2C(=O)c3ccc(C(c4ccc5c(c4)C(=O)N(c4ccc(F)c(N)c4)C5=O)(C(F)(F)F)C(F)(F)F)cc3C2=O)ccc1F |
| InChI | InChI=1S/C31H16F8N4O4/c32-21-7-3-15(11-23(21)40)42-25(44)17-5-1-13(9-19(17)27(42)46)29(30(34,35)36,31(37,38)39)14-2-6-18-20(10-14)28(47)43(26(18)45)16-4-8-22(33)24(41)12-16/h1-12H,40-41H2 |
| InChIKey | AOPGYYAGOLMAMB-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 126.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 660.48 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|