C33H18Cl2F6N2O4 — CID 20704286
5-[2-[2-[3-chloro-4-(2-chloro-4-methylphenyl)phenyl]-1,3-dioxoisoindol-5-yl]-1,1,1,3,3,3-hexafluoropropan-2-yl]-2-methylisoindole-1,3-dione (PubChem CID 20704286) has the molecular formula C33H18Cl2F6N2O4 and a molecular weight of 691.41 g/mol. Its IUPAC name is 5-[2-[2-[3-chloro-4-(2-chloro-4-methylphenyl)phenyl]-1,3-dioxoisoindol-5-yl]-1,1,1,3,3,3-hexafluoropropan-2-yl]-2-methylisoindole-1,3-dione.
| Compound Name | 5-[2-[2-[3-chloro-4-(2-chloro-4-methylphenyl)phenyl]-1,3-dioxoisoindol-5-yl]-1,1,1,3,3,3-hexafluoropropan-2-yl]-2-methylisoindole-1,3-dione |
|---|---|
| PubChem CID | 20704286 |
| Molecular Formula | C33H18Cl2F6N2O4 |
| Molecular Weight | 691.41 g/mol |
| Exact Mass | 690.05 |
| IUPAC Name | 5-[2-[2-[3-chloro-4-(2-chloro-4-methylphenyl)phenyl]-1,3-dioxoisoindol-5-yl]-1,1,1,3,3,3-hexafluoropropan-2-yl]-2-methylisoindole-1,3-dione |
| SMILES | Cc1ccc(-c2ccc(N3C(=O)c4ccc(C(c5ccc6c(c5)C(=O)N(C)C6=O)(C(F)(F)F)C(F)(F)F)cc4C3=O)cc2Cl)c(Cl)c1 |
| InChI | InChI=1S/C33H18Cl2F6N2O4/c1-15-3-7-19(25(34)11-15)20-10-6-18(14-26(20)35)43-29(46)22-9-5-17(13-24(22)30(43)47)31(32(36,37)38,33(39,40)41)16-4-8-21-23(12-16)28(45)42(2)27(21)44/h3-14H,1-2H3 |
| InChIKey | WHUMOJDRQNZKOF-UHFFFAOYSA-N |
| XLogP | 8.41 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 691.41 |
| LogP ≤ 5 | 8.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|