C32H18F6N2O11S2 — CID 121426785
2-[4-[5-[2-(1,3-dioxoisoindol-5-yl)-1,1,1,3,3,3-hexafluoropropan-2-yl]-1,3-dioxoisoindol-2-yl]-2-sulfophenoxy]-5-methylbenzenesulfonic acid (PubChem CID 121426785) has the molecular formula C32H18F6N2O11S2 and a molecular weight of 784.62 g/mol. Its IUPAC name is 2-[4-[5-[2-(1,3-dioxoisoindol-5-yl)-1,1,1,3,3,3-hexafluoropropan-2-yl]-1,3-dioxoisoindol-2-yl]-2-sulfophenoxy]-5-methylbenzenesulfonic acid.
| Compound Name | 2-[4-[5-[2-(1,3-dioxoisoindol-5-yl)-1,1,1,3,3,3-hexafluoropropan-2-yl]-1,3-dioxoisoindol-2-yl]-2-sulfophenoxy]-5-methylbenzenesulfonic acid |
|---|---|
| PubChem CID | 121426785 |
| Molecular Formula | C32H18F6N2O11S2 |
| Molecular Weight | 784.62 g/mol |
| Exact Mass | 784.03 |
| IUPAC Name | 2-[4-[5-[2-(1,3-dioxoisoindol-5-yl)-1,1,1,3,3,3-hexafluoropropan-2-yl]-1,3-dioxoisoindol-2-yl]-2-sulfophenoxy]-5-methylbenzenesulfonic acid |
| SMILES | Cc1ccc(Oc2ccc(N3C(=O)c4ccc(C(c5ccc6c(c5)C(=O)NC6=O)(C(F)(F)F)C(F)(F)F)cc4C3=O)cc2S(=O)(=O)O)c(S(=O)(=O)O)c1 |
| InChI | InChI=1S/C32H18F6N2O11S2/c1-14-2-8-22(24(10-14)52(45,46)47)51-23-9-5-17(13-25(23)53(48,49)50)40-28(43)19-7-4-16(12-21(19)29(40)44)30(31(33,34)35,32(36,37)38)15-3-6-18-20(11-15)27(42)39-26(18)41/h2-13H,1H3,(H,39,41,42)(H,45,46,47)(H,48,49,50) |
| InChIKey | MZDVFVCRMNWLET-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 201.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 784.62 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|