C30H22N2O11S2 — CID 149055800
2-[4-[5-[(3-hydroxy-2-methyl-1-oxo-3H-isoindol-5-yl)oxy]-1,3-dioxoisoindol-2-yl]-2-sulfophenyl]-5-methylbenzenesulfonic acid (PubChem CID 149055800) has the molecular formula C30H22N2O11S2 and a molecular weight of 650.64 g/mol. Its IUPAC name is 2-[4-[5-[(3-hydroxy-2-methyl-1-oxo-3H-isoindol-5-yl)oxy]-1,3-dioxoisoindol-2-yl]-2-sulfophenyl]-5-methylbenzenesulfonic acid.
| Compound Name | 2-[4-[5-[(3-hydroxy-2-methyl-1-oxo-3H-isoindol-5-yl)oxy]-1,3-dioxoisoindol-2-yl]-2-sulfophenyl]-5-methylbenzenesulfonic acid |
|---|---|
| PubChem CID | 149055800 |
| Molecular Formula | C30H22N2O11S2 |
| Molecular Weight | 650.64 g/mol |
| Exact Mass | 650.07 |
| IUPAC Name | 2-[4-[5-[(3-hydroxy-2-methyl-1-oxo-3H-isoindol-5-yl)oxy]-1,3-dioxoisoindol-2-yl]-2-sulfophenyl]-5-methylbenzenesulfonic acid |
| SMILES | Cc1ccc(-c2ccc(N3C(=O)c4ccc(Oc5ccc6c(c5)C(O)N(C)C6=O)cc4C3=O)cc2S(=O)(=O)O)c(S(=O)(=O)O)c1 |
| InChI | InChI=1S/C30H22N2O11S2/c1-15-3-7-19(25(11-15)44(37,38)39)20-8-4-16(12-26(20)45(40,41)42)32-29(35)22-10-6-18(14-24(22)30(32)36)43-17-5-9-21-23(13-17)28(34)31(2)27(21)33/h3-14,28,34H,1-2H3,(H,37,38,39)(H,40,41,42) |
| InChIKey | QKSDRAQAPHOKJI-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 195.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.64 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|