C28H18N2O5 — CID 142393891
2-[3-(1-hydroxy-3-oxo-6-phenoxy-1H-isoindol-2-yl)phenyl]isoindole-1,3-dione (PubChem CID 142393891) has the molecular formula C28H18N2O5 and a molecular weight of 462.46 g/mol. Its IUPAC name is 2-[3-(1-hydroxy-3-oxo-6-phenoxy-1H-isoindol-2-yl)phenyl]isoindole-1,3-dione.
| Compound Name | 2-[3-(1-hydroxy-3-oxo-6-phenoxy-1H-isoindol-2-yl)phenyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 142393891 |
| Molecular Formula | C28H18N2O5 |
| Molecular Weight | 462.46 g/mol |
| Exact Mass | 462.12 |
| IUPAC Name | 2-[3-(1-hydroxy-3-oxo-6-phenoxy-1H-isoindol-2-yl)phenyl]isoindole-1,3-dione |
| SMILES | O=C1c2ccccc2C(=O)N1c1cccc(N2C(=O)c3ccc(Oc4ccccc4)cc3C2O)c1 |
| InChI | InChI=1S/C28H18N2O5/c31-25-21-11-4-5-12-22(21)26(32)29(25)17-7-6-8-18(15-17)30-27(33)23-14-13-20(16-24(23)28(30)34)35-19-9-2-1-3-10-19/h1-16,28,34H |
| InChIKey | OOUYFKOUXNZZOS-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 87.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.46 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|