C34H20N2O8 — CID 17386922
2-(3-hydroxyphenyl)-5-[3-[2-(3-hydroxyphenyl)-1,3-dioxoisoindol-5-yl]oxyphenoxy]isoindole-1,3-dione (PubChem CID 17386922) has the molecular formula C34H20N2O8 and a molecular weight of 584.54 g/mol. Its IUPAC name is 2-(3-hydroxyphenyl)-5-[3-[2-(3-hydroxyphenyl)-1,3-dioxoisoindol-5-yl]oxyphenoxy]isoindole-1,3-dione.
| Compound Name | 2-(3-hydroxyphenyl)-5-[3-[2-(3-hydroxyphenyl)-1,3-dioxoisoindol-5-yl]oxyphenoxy]isoindole-1,3-dione |
|---|---|
| PubChem CID | 17386922 |
| Molecular Formula | C34H20N2O8 |
| Molecular Weight | 584.54 g/mol |
| Exact Mass | 584.12 |
| IUPAC Name | 2-(3-hydroxyphenyl)-5-[3-[2-(3-hydroxyphenyl)-1,3-dioxoisoindol-5-yl]oxyphenoxy]isoindole-1,3-dione |
| SMILES | O=C1c2ccc(Oc3cccc(Oc4ccc5c(c4)C(=O)N(c4cccc(O)c4)C5=O)c3)cc2C(=O)N1c1cccc(O)c1 |
| InChI | InChI=1S/C34H20N2O8/c37-21-6-1-4-19(14-21)35-31(39)27-12-10-25(17-29(27)33(35)41)43-23-8-3-9-24(16-23)44-26-11-13-28-30(18-26)34(42)36(32(28)40)20-5-2-7-22(38)15-20/h1-18,37-38H |
| InChIKey | LFKKQFYCAAEJDO-UHFFFAOYSA-N |
| XLogP | 6.28 |
| TPSA | 133.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.54 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|